About 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one
4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 736265) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 736265 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C16H11NO3/c18-15(12-9-5-2-6-10-12)13-14(17-20-16(13)19)11-7-3-1-4-8-11/h1-10,17H |
| InChIKey | LEZIJKQVDLLCKA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one?
The IUPAC name of 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one (CID 736265) is 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one is O=C(c1ccccc1)c1c(-c2ccccc2)[nH]oc1=O.
What is the InChIKey of 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one?
The InChIKey is LEZIJKQVDLLCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO3/c18-15(12-9-5-2-6-10-12)13-14(17-20-16(13)19)11-7-3-1-4-8-11/h1-10,17H.
What are the key properties of 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one?
4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one has a molecular weight of 265.27 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-3-phenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 736265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).