About benzyl (2S)-2-amino-3-phenylpropanoate
benzyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 736312) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | benzyl (2S)-2-amino-3-phenylpropanoate |
| PubChem CID | 736312 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | benzyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14/h1-10,15H,11-12,17H2/t15-/m0/s1 |
| InChIKey | FPRSPUHXEPWUBZ-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2S)-2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-amino-3-phenylpropanoate?
The IUPAC name of benzyl (2S)-2-amino-3-phenylpropanoate (CID 736312) is benzyl (2S)-2-amino-3-phenylpropanoate.
What is the SMILES notation for benzyl (2S)-2-amino-3-phenylpropanoate?
The canonical SMILES for benzyl (2S)-2-amino-3-phenylpropanoate is N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (2S)-2-amino-3-phenylpropanoate?
The InChIKey is FPRSPUHXEPWUBZ-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H17NO2/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14/h1-10,15H,11-12,17H2/t15-/m0/s1.
What are the key properties of benzyl (2S)-2-amino-3-phenylpropanoate?
benzyl (2S)-2-amino-3-phenylpropanoate has a molecular weight of 255.32 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-amino-3-phenylpropanoate is sourced from PubChem (CID 736312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).