About naphthalen-1-ylthiourea
naphthalen-1-ylthiourea (PubChem CID 736366) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is naphthalen-1-ylthiourea.
Molecular Properties
| Compound Name | naphthalen-1-ylthiourea |
| PubChem CID | 736366 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | naphthalen-1-ylthiourea |
| SMILES | NC(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10N2S/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H3,12,13,14) |
| InChIKey | PIVQQUNOTICCSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylthiourea?
The IUPAC name of naphthalen-1-ylthiourea (CID 736366) is naphthalen-1-ylthiourea.
What is the SMILES notation for naphthalen-1-ylthiourea?
The canonical SMILES for naphthalen-1-ylthiourea is NC(=S)Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylthiourea?
The InChIKey is PIVQQUNOTICCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H3,12,13,14).
What are the key properties of naphthalen-1-ylthiourea?
naphthalen-1-ylthiourea has a molecular weight of 202.28 g/mol, XLogP of 2.50, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylthiourea is sourced from PubChem (CID 736366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).