About propyl 3-sulfanylpropanoate
propyl 3-sulfanylpropanoate (PubChem CID 7364136) has the molecular formula C6H12O2S
and a molecular weight of 148.23 g/mol. Its IUPAC name is propyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | propyl 3-sulfanylpropanoate |
| PubChem CID | 7364136 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | propyl 3-sulfanylpropanoate |
| SMILES | CCCOC(=O)CCS |
| InChI | InChI=1S/C6H12O2S/c1-2-4-8-6(7)3-5-9/h9H,2-5H2,1H3 |
| InChIKey | RIMHDIYZJQVNSO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-sulfanylpropanoate?
The IUPAC name of propyl 3-sulfanylpropanoate (CID 7364136) is propyl 3-sulfanylpropanoate.
What is the SMILES notation for propyl 3-sulfanylpropanoate?
The canonical SMILES for propyl 3-sulfanylpropanoate is CCCOC(=O)CCS.
What is the InChIKey of propyl 3-sulfanylpropanoate?
The InChIKey is RIMHDIYZJQVNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-2-4-8-6(7)3-5-9/h9H,2-5H2,1H3.
What are the key properties of propyl 3-sulfanylpropanoate?
propyl 3-sulfanylpropanoate has a molecular weight of 148.23 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-sulfanylpropanoate is sourced from PubChem (CID 7364136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).