C20H21N3O8S — CID 7364162
4-[4-[[4-(3-carboxypropanoylamino)phenyl]sulfonylamino]anilino]-4-oxobutanoic acid (PubChem CID 7364162) has the molecular formula C20H21N3O8S and a molecular weight of 463.47 g/mol. Its IUPAC name is 4-[4-[[4-(3-carboxypropanoylamino)phenyl]sulfonylamino]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[[4-(3-carboxypropanoylamino)phenyl]sulfonylamino]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7364162 |
| Molecular Formula | C20H21N3O8S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 4-[4-[[4-(3-carboxypropanoylamino)phenyl]sulfonylamino]anilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(NS(=O)(=O)c2ccc(NC(=O)CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O8S/c24-17(9-11-19(26)27)21-13-1-3-15(4-2-13)23-32(30,31)16-7-5-14(6-8-16)22-18(25)10-12-20(28)29/h1-8,23H,9-12H2,(H,21,24)(H,22,25)(H,26,27)(H,28,29) |
| InChIKey | QXSTURLHKMCHDO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 178.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |