About [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate (PubChem CID 7364862) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate.
Molecular Properties
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate |
| PubChem CID | 7364862 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H27NO4/c1-11(18-15(19)9-22-16(20)10-21-2)17-6-12-3-13(7-17)5-14(4-12)8-17/h11-14H,3-10H2,1-2H3,(H,18,19)/t11-,12?,13?,14?,17?/m0/s1 |
| InChIKey | LZRGDNUEMRTTKD-GVMDUPDNSA-N |
| XLogP | 1.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate?
The IUPAC name of [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate (CID 7364862) is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate.
What is the SMILES notation for [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate?
The canonical SMILES for [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate is COCC(=O)OCC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate?
The InChIKey is LZRGDNUEMRTTKD-GVMDUPDNSA-N. The full InChI is InChI=1S/C17H27NO4/c1-11(18-15(19)9-22-16(20)10-21-2)17-6-12-3-13(7-17)5-14(4-12)8-17/h11-14H,3-10H2,1-2H3,(H,18,19)/t11-,12?,13?,14?,17?/m0/s1.
What are the key properties of [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate?
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate has a molecular weight of 309.41 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-methoxyacetate is sourced from PubChem (CID 7364862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).