C8H2I3NO4-2 — CID 7364867
5-amino-2,4,6-triiodobenzene-1,3-dicarboxylate (PubChem CID 7364867) has the molecular formula C8H2I3NO4-2 and a molecular weight of 556.82 g/mol. Its IUPAC name is 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylate.
| Compound Name | 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7364867 |
| Molecular Formula | C8H2I3NO4-2 |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.71 |
| IUPAC Name | 5-amino-2,4,6-triiodobenzene-1,3-dicarboxylate |
| SMILES | Nc1c(I)c(C(=O)[O-])c(I)c(C(=O)[O-])c1I |
| InChI | InChI=1S/C8H4I3NO4/c9-3-1(7(13)14)4(10)6(12)5(11)2(3)8(15)16/h12H2,(H,13,14)(H,15,16)/p-2 |
| InChIKey | JEZJSNULLBSYHV-UHFFFAOYSA-L |
| XLogP | -0.19 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|