About 3-pyrrol-1-ylbenzoic acid
3-pyrrol-1-ylbenzoic acid (PubChem CID 736537) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-pyrrol-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 3-pyrrol-1-ylbenzoic acid |
| PubChem CID | 736537 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 3-pyrrol-1-ylbenzoic acid |
| SMILES | O=C(O)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14) |
| InChIKey | PODFNQCZFHLJPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-pyrrol-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrol-1-ylbenzoic acid?
The IUPAC name of 3-pyrrol-1-ylbenzoic acid (CID 736537) is 3-pyrrol-1-ylbenzoic acid.
What is the SMILES notation for 3-pyrrol-1-ylbenzoic acid?
The canonical SMILES for 3-pyrrol-1-ylbenzoic acid is O=C(O)c1cccc(-n2cccc2)c1.
What is the InChIKey of 3-pyrrol-1-ylbenzoic acid?
The InChIKey is PODFNQCZFHLJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14).
What are the key properties of 3-pyrrol-1-ylbenzoic acid?
3-pyrrol-1-ylbenzoic acid has a molecular weight of 187.20 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrol-1-ylbenzoic acid is sourced from PubChem (CID 736537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).