C17H16ClNO4 — CID 7366056
[2-(2,5-dimethylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 7366056) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7366056 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)COC(=O)c2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C17H16ClNO4/c1-10-3-4-11(2)14(7-10)19-16(21)9-23-17(22)13-8-12(18)5-6-15(13)20/h3-8,20H,9H2,1-2H3,(H,19,21) |
| InChIKey | AJFHTQHQGDLLFZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |