About 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde
5-chloro-1,3-diphenylpyrazole-4-carbaldehyde (PubChem CID 736659) has the molecular formula C16H11ClN2O
and a molecular weight of 282.73 g/mol. Its IUPAC name is 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde |
| PubChem CID | 736659 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C16H11ClN2O/c17-16-14(11-20)15(12-7-3-1-4-8-12)18-19(16)13-9-5-2-6-10-13/h1-11H |
| InChIKey | BORJDGPYDJKXPV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde?
The IUPAC name of 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde (CID 736659) is 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde.
What is the SMILES notation for 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde?
The canonical SMILES for 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde is O=Cc1c(-c2ccccc2)nn(-c2ccccc2)c1Cl.
What is the InChIKey of 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde?
The InChIKey is BORJDGPYDJKXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O/c17-16-14(11-20)15(12-7-3-1-4-8-12)18-19(16)13-9-5-2-6-10-13/h1-11H.
What are the key properties of 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde?
5-chloro-1,3-diphenylpyrazole-4-carbaldehyde has a molecular weight of 282.73 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-diphenylpyrazole-4-carbaldehyde is sourced from PubChem (CID 736659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).