C11H19N5O2S+2 — CID 7367077
5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7367077) has the molecular formula C11H19N5O2S+2 and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7367077 |
| Molecular Formula | C11H19N5O2S+2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1/C=N/CC[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C11H17N5O2S/c17-9-8(10(18)15-11(19)14-9)7-13-3-6-16-4-1-12-2-5-16/h7-8,12H,1-6H2,(H2,14,15,17,18,19)/p+2/b13-7+ |
| InChIKey | RIPDKEPCRVZONC-NTUHNPAUSA-P |
| XLogP | -4.33 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|