C17H29N4O3+ — CID 7367154
2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium (PubChem CID 7367154) has the molecular formula C17H29N4O3+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium.
| Compound Name | 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7367154 |
| Molecular Formula | C17H29N4O3+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C17H28N4O3/c1-3-20(4-2)11-10-18-12-14-15(22)19-17(24)21(16(14)23)13-8-6-5-7-9-13/h12-14H,3-11H2,1-2H3,(H,19,22,24)/p+1/b18-12+ |
| InChIKey | ZWKQXUOMYHTSHM-LDADJPATSA-O |
| XLogP | 0.01 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|