C17H28N4O3 — CID 7367155
1-cyclohexyl-5-[2-(diethylamino)ethyliminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7367155) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-cyclohexyl-5-[2-(diethylamino)ethyliminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-cyclohexyl-5-[2-(diethylamino)ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367155 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-cyclohexyl-5-[2-(diethylamino)ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)CC/N=C/C1C(=O)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C17H28N4O3/c1-3-20(4-2)11-10-18-12-14-15(22)19-17(24)21(16(14)23)13-8-6-5-7-9-13/h12-14H,3-11H2,1-2H3,(H,19,22,24)/b18-12+ |
| InChIKey | ZWKQXUOMYHTSHM-LDADJPATSA-N |
| XLogP | 1.43 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|