C21H25N5O3+2 — CID 7367244
(5S)-1-naphthalen-1-yl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7367244) has the molecular formula C21H25N5O3+2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (5S)-1-naphthalen-1-yl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-naphthalen-1-yl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367244 |
| Molecular Formula | C21H25N5O3+2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (5S)-1-naphthalen-1-yl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc3ccccc23)C(=O)[C@H]1/C=N/CC[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C21H23N5O3/c27-19-17(14-23-10-13-25-11-8-22-9-12-25)20(28)26(21(29)24-19)18-7-3-5-15-4-1-2-6-16(15)18/h1-7,14,17,22H,8-13H2,(H,24,27,29)/p+2/b23-14+/t17-/m0/s1 |
| InChIKey | ARYFOEGQPUZDKX-QIWJOQEQSA-P |
| XLogP | -1.43 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|