C15H26N4O2S — CID 7367267
5-[2-(diethylamino)ethyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7367267) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[2-(diethylamino)ethyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7367267 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 5-[2-(diethylamino)ethyliminomethyl]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN(CC)CC/N=C/C1C(=O)N(CC)C(=S)N(CC)C1=O |
| InChI | InChI=1S/C15H26N4O2S/c1-5-17(6-2)10-9-16-11-12-13(20)18(7-3)15(22)19(8-4)14(12)21/h11-12H,5-10H2,1-4H3/b16-11+ |
| InChIKey | UFDWUYGJIRJITP-LFIBNONCSA-N |
| XLogP | 1.01 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|