C18H29N4O3+ — CID 7367293
(5R)-1-cyclohexyl-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7367293) has the molecular formula C18H29N4O3+ and a molecular weight of 349.46 g/mol. Its IUPAC name is (5R)-1-cyclohexyl-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-cyclohexyl-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367293 |
| Molecular Formula | C18H29N4O3+ |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (5R)-1-cyclohexyl-5-(2-piperidin-1-ium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)[C@@H]1/C=N/CC[NH+]1CCCCC1 |
| InChI | InChI=1S/C18H28N4O3/c23-16-15(13-19-9-12-21-10-5-2-6-11-21)17(24)22(18(25)20-16)14-7-3-1-4-8-14/h13-15H,1-12H2,(H,20,23,25)/p+1/b19-13+/t15-/m1/s1 |
| InChIKey | FTHQQAUDNDUVPE-DQPIFXJKSA-O |
| XLogP | 0.15 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|