C9H6F5NOS — CID 7367475
4,4,5,5,5-pentafluoro-3-imino-1-thiophen-2-ylpentan-1-one (PubChem CID 7367475) has the molecular formula C9H6F5NOS and a molecular weight of 271.21 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-imino-1-thiophen-2-ylpentan-1-one.
| Compound Name | 4,4,5,5,5-pentafluoro-3-imino-1-thiophen-2-ylpentan-1-one |
|---|---|
| PubChem CID | 7367475 |
| Molecular Formula | C9H6F5NOS |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-imino-1-thiophen-2-ylpentan-1-one |
| SMILES | [H]/N=C(/CC(=O)c1cccs1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NOS/c10-8(11,9(12,13)14)7(15)4-5(16)6-2-1-3-17-6/h1-3,15H,4H2/b15-7- |
| InChIKey | IGKVXNXZLFRJKD-CHHVJCJISA-N |
| XLogP | 3.54 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|