C19H21N5O3 — CID 7367599
(5R)-1-(4-ethylphenyl)-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7367599) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is (5R)-1-(4-ethylphenyl)-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-(4-ethylphenyl)-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367599 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (5R)-1-(4-ethylphenyl)-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/CCCn3ccnc3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N5O3/c1-2-14-4-6-15(7-5-14)24-18(26)16(17(25)22-19(24)27)12-20-8-3-10-23-11-9-21-13-23/h4-7,9,11-13,16H,2-3,8,10H2,1H3,(H,22,25,27)/b20-12+/t16-/m1/s1 |
| InChIKey | FHGTXSGPMKEYNS-DDLUMYACSA-N |
| XLogP | 1.81 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|