C14H23N5O3+2 — CID 7367647
(5S)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 7367647) has the molecular formula C14H23N5O3+2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (5S)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367647 |
| Molecular Formula | C14H23N5O3+2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (5S)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)[C@H](/C=N/CC[NH+]2CC[NH2+]CC2)C1=O |
| InChI | InChI=1S/C14H21N5O3/c1-2-6-19-13(21)11(12(20)17-14(19)22)10-16-5-9-18-7-3-15-4-8-18/h2,10-11,15H,1,3-9H2,(H,17,20,22)/p+2/b16-10+/t11-/m0/s1 |
| InChIKey | IARKVHFXPGBKCR-YAFRSCOQSA-P |
| XLogP | -3.60 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|