C14H21N5O3 — CID 7367648
(5S)-5-(2-piperazin-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 7367648) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (5S)-5-(2-piperazin-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-(2-piperazin-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367648 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (5S)-5-(2-piperazin-1-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)[C@H](/C=N/CCN2CCNCC2)C1=O |
| InChI | InChI=1S/C14H21N5O3/c1-2-6-19-13(21)11(12(20)17-14(19)22)10-16-5-9-18-7-3-15-4-8-18/h2,10-11,15H,1,3-9H2,(H,17,20,22)/b16-10+/t11-/m0/s1 |
| InChIKey | IARKVHFXPGBKCR-YAFRSCOQSA-N |
| XLogP | -1.16 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|