C10H17N4O2S+ — CID 7367754
3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium (PubChem CID 7367754) has the molecular formula C10H17N4O2S+ and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7367754 |
| Molecular Formula | C10H17N4O2S+ |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCC/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C10H16N4O2S/c1-14(2)5-3-4-11-6-7-8(15)12-10(17)13-9(7)16/h6-7H,3-5H2,1-2H3,(H2,12,13,15,16,17)/p+1/b11-6+ |
| InChIKey | RTTLVJOTCCGYFL-IZZDOVSWSA-O |
| XLogP | -2.26 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|