C12H18N4O3 — CID 7367804
5-[2-(dimethylamino)ethyliminomethyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 7367804) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyliminomethyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-(dimethylamino)ethyliminomethyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367804 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-[2-(dimethylamino)ethyliminomethyl]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)C(/C=N/CCN(C)C)C1=O |
| InChI | InChI=1S/C12H18N4O3/c1-4-6-16-11(18)9(10(17)14-12(16)19)8-13-5-7-15(2)3/h4,8-9H,1,5-7H2,2-3H3,(H,14,17,19)/b13-8+ |
| InChIKey | LXDADMZQZSKXSO-MDWZMJQESA-N |
| XLogP | -0.50 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|