C19H28N4O5+2 — CID 7367854
6,6-dimethyl-5,7-dinitro-2-(4-propan-2-yloxyphenyl)-1,3-diazoniatricyclo[3.3.1.13,7]decane (PubChem CID 7367854) has the molecular formula C19H28N4O5+2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dinitro-2-(4-propan-2-yloxyphenyl)-1,3-diazoniatricyclo[3.3.1.13,7]decane.
| Compound Name | 6,6-dimethyl-5,7-dinitro-2-(4-propan-2-yloxyphenyl)-1,3-diazoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 7367854 |
| Molecular Formula | C19H28N4O5+2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 6,6-dimethyl-5,7-dinitro-2-(4-propan-2-yloxyphenyl)-1,3-diazoniatricyclo[3.3.1.13,7]decane |
| SMILES | CC(C)Oc1ccc(C2[NH+]3CC4([N+](=O)[O-])C[NH+]2CC([N+](=O)[O-])(C3)C4(C)C)cc1 |
| InChI | InChI=1S/C19H26N4O5/c1-13(2)28-15-7-5-14(6-8-15)16-20-9-18(22(24)25)10-21(16)12-19(11-20,23(26)27)17(18,3)4/h5-8,13,16H,9-12H2,1-4H3/p+2 |
| InChIKey | NFMUIUWMXNDUHA-UHFFFAOYSA-P |
| XLogP | -0.66 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|