C11H16N4O4 — CID 7367872
5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7367872) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367872 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/CCN2CCOCC2)C(=O)N1 |
| InChI | InChI=1S/C11H16N4O4/c16-9-8(10(17)14-11(18)13-9)7-12-1-2-15-3-5-19-6-4-15/h7-8H,1-6H2,(H2,13,14,16,17,18)/b12-7+ |
| InChIKey | QXGDOWHXRZGWGE-KPKJPENVSA-N |
| XLogP | -1.63 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|