C13H20N4O3S — CID 7367912
1,3-dimethyl-5-(2-morpholin-4-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7367912) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2-morpholin-4-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dimethyl-5-(2-morpholin-4-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7367912 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1,3-dimethyl-5-(2-morpholin-4-ylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(/C=N/CCN2CCOCC2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C13H20N4O3S/c1-15-11(18)10(12(19)16(2)13(15)21)9-14-3-4-17-5-7-20-8-6-17/h9-10H,3-8H2,1-2H3/b14-9+ |
| InChIKey | MBIAJBNDEXVQOS-NTEUORMPSA-N |
| XLogP | -0.78 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|