C18H22N4O4 — CID 7368004
(5S)-1-(3-methylphenyl)-5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7368004) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is (5S)-1-(3-methylphenyl)-5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(3-methylphenyl)-5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7368004 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (5S)-1-(3-methylphenyl)-5-(2-morpholin-4-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cccc(N2C(=O)NC(=O)[C@H](/C=N/CCN3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-13-3-2-4-14(11-13)22-17(24)15(16(23)20-18(22)25)12-19-5-6-21-7-9-26-10-8-21/h2-4,11-12,15H,5-10H2,1H3,(H,20,23,25)/b19-12+/t15-/m0/s1 |
| InChIKey | NLSRLJWPBDWANB-UZUMKDMXSA-N |
| XLogP | 0.60 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|