About 12H-quinoxalino[2,3-b][1,4]benzoxazine
12H-quinoxalino[2,3-b][1,4]benzoxazine (PubChem CID 736801) has the molecular formula C14H9N3O
and a molecular weight of 235.25 g/mol. Its IUPAC name is 12H-quinoxalino[2,3-b][1,4]benzoxazine.
Molecular Properties
| Compound Name | 12H-quinoxalino[2,3-b][1,4]benzoxazine |
| PubChem CID | 736801 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 12H-quinoxalino[2,3-b][1,4]benzoxazine |
| SMILES | c1ccc2c(c1)Nc1nc3ccccc3nc1O2 |
| InChI | InChI=1S/C14H9N3O/c1-2-6-10-9(5-1)15-13-14(17-10)18-12-8-4-3-7-11(12)16-13/h1-8H,(H,15,16) |
| InChIKey | DVVDOLPZDYBCBZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 12H-quinoxalino[2,3-b][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-quinoxalino[2,3-b][1,4]benzoxazine?
The IUPAC name of 12H-quinoxalino[2,3-b][1,4]benzoxazine (CID 736801) is 12H-quinoxalino[2,3-b][1,4]benzoxazine.
What is the SMILES notation for 12H-quinoxalino[2,3-b][1,4]benzoxazine?
The canonical SMILES for 12H-quinoxalino[2,3-b][1,4]benzoxazine is c1ccc2c(c1)Nc1nc3ccccc3nc1O2.
What is the InChIKey of 12H-quinoxalino[2,3-b][1,4]benzoxazine?
The InChIKey is DVVDOLPZDYBCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O/c1-2-6-10-9(5-1)15-13-14(17-10)18-12-8-4-3-7-11(12)16-13/h1-8H,(H,15,16).
What are the key properties of 12H-quinoxalino[2,3-b][1,4]benzoxazine?
12H-quinoxalino[2,3-b][1,4]benzoxazine has a molecular weight of 235.25 g/mol, XLogP of 3.48, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-quinoxalino[2,3-b][1,4]benzoxazine is sourced from PubChem (CID 736801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).