C13H21N4O2S+ — CID 7368064
3-[(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium (PubChem CID 7368064) has the molecular formula C13H21N4O2S+ and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7368064 |
| Molecular Formula | C13H21N4O2S+ |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-[(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
| SMILES | C=CCN1C(=O)C(/C=N/CCC[NH+](C)C)C(=O)NC1=S |
| InChI | InChI=1S/C13H20N4O2S/c1-4-7-17-12(19)10(11(18)15-13(17)20)9-14-6-5-8-16(2)3/h4,9-10H,1,5-8H2,2-3H3,(H,15,18,20)/p+1/b14-9+ |
| InChIKey | QPFANLGSCWKHDU-NTEUORMPSA-O |
| XLogP | -1.36 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|