C11H19N4O2S+ — CID 7368108
dimethyl-[3-[[(5R)-1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl]azanium (PubChem CID 7368108) has the molecular formula C11H19N4O2S+ and a molecular weight of 271.37 g/mol. Its IUPAC name is dimethyl-[3-[[(5R)-1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl]azanium.
| Compound Name | dimethyl-[3-[[(5R)-1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7368108 |
| Molecular Formula | C11H19N4O2S+ |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | dimethyl-[3-[[(5R)-1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl]azanium |
| SMILES | CN1C(=O)[C@H](/C=N/CCC[NH+](C)C)C(=O)NC1=S |
| InChI | InChI=1S/C11H18N4O2S/c1-14(2)6-4-5-12-7-8-9(16)13-11(18)15(3)10(8)17/h7-8H,4-6H2,1-3H3,(H,13,16,18)/p+1/b12-7+/t8-/m1/s1 |
| InChIKey | BTZBFVDULXPGES-LQGZHCLWSA-O |
| XLogP | -1.92 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|