C16H15F2NO2 — CID 7369079
(2S)-N-(3,5-difluorophenyl)-2-phenoxybutanamide (PubChem CID 7369079) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is (2S)-N-(3,5-difluorophenyl)-2-phenoxybutanamide.
| Compound Name | (2S)-N-(3,5-difluorophenyl)-2-phenoxybutanamide |
|---|---|
| PubChem CID | 7369079 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2S)-N-(3,5-difluorophenyl)-2-phenoxybutanamide |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15F2NO2/c1-2-15(21-14-6-4-3-5-7-14)16(20)19-13-9-11(17)8-12(18)10-13/h3-10,15H,2H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | YDRDHDUBPLBYQT-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |