About N-benzyl-3,4,5-trimethoxybenzamide
N-benzyl-3,4,5-trimethoxybenzamide (PubChem CID 736962) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is N-benzyl-3,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-benzyl-3,4,5-trimethoxybenzamide |
| PubChem CID | 736962 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-benzyl-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO4/c1-20-14-9-13(10-15(21-2)16(14)22-3)17(19)18-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,18,19) |
| InChIKey | IUHYGONSJUAHBM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-3,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3,4,5-trimethoxybenzamide?
The IUPAC name of N-benzyl-3,4,5-trimethoxybenzamide (CID 736962) is N-benzyl-3,4,5-trimethoxybenzamide.
What is the SMILES notation for N-benzyl-3,4,5-trimethoxybenzamide?
The canonical SMILES for N-benzyl-3,4,5-trimethoxybenzamide is COc1cc(C(=O)NCc2ccccc2)cc(OC)c1OC.
What is the InChIKey of N-benzyl-3,4,5-trimethoxybenzamide?
The InChIKey is IUHYGONSJUAHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4/c1-20-14-9-13(10-15(21-2)16(14)22-3)17(19)18-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,18,19).
What are the key properties of N-benzyl-3,4,5-trimethoxybenzamide?
N-benzyl-3,4,5-trimethoxybenzamide has a molecular weight of 301.34 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3,4,5-trimethoxybenzamide is sourced from PubChem (CID 736962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).