About 3-phenyl-1,3-benzothiazol-2-imine
3-phenyl-1,3-benzothiazol-2-imine (PubChem CID 736970) has the molecular formula C13H10N2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-phenyl-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 3-phenyl-1,3-benzothiazol-2-imine |
| PubChem CID | 736970 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-phenyl-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C13H10N2S/c14-13-15(10-6-2-1-3-7-10)11-8-4-5-9-12(11)16-13/h1-9,14H/b14-13- |
| InChIKey | WMUQKQNUCODDCB-YPKPFQOOSA-N |
| XLogP | 3.17 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,3-benzothiazol-2-imine?
The IUPAC name of 3-phenyl-1,3-benzothiazol-2-imine (CID 736970) is 3-phenyl-1,3-benzothiazol-2-imine.
What is the SMILES notation for 3-phenyl-1,3-benzothiazol-2-imine?
The canonical SMILES for 3-phenyl-1,3-benzothiazol-2-imine is [H]/N=c1\sc2ccccc2n1-c1ccccc1.
What is the InChIKey of 3-phenyl-1,3-benzothiazol-2-imine?
The InChIKey is WMUQKQNUCODDCB-YPKPFQOOSA-N. The full InChI is InChI=1S/C13H10N2S/c14-13-15(10-6-2-1-3-7-10)11-8-4-5-9-12(11)16-13/h1-9,14H/b14-13-.
What are the key properties of 3-phenyl-1,3-benzothiazol-2-imine?
3-phenyl-1,3-benzothiazol-2-imine has a molecular weight of 226.30 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,3-benzothiazol-2-imine is sourced from PubChem (CID 736970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).