C9H9N5OS — CID 736996
6-sulfanylidenespiro[1,2,4,5-tetrazinane-3,3'-1H-indole]-2'-one (PubChem CID 736996) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-sulfanylidenespiro[1,2,4,5-tetrazinane-3,3'-1H-indole]-2'-one.
| Compound Name | 6-sulfanylidenespiro[1,2,4,5-tetrazinane-3,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 736996 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 6-sulfanylidenespiro[1,2,4,5-tetrazinane-3,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccccc2C12NNC(=S)NN2 |
| InChI | InChI=1S/C9H9N5OS/c15-7-9(13-11-8(16)12-14-9)5-3-1-2-4-6(5)10-7/h1-4,13-14H,(H,10,15)(H2,11,12,16) |
| InChIKey | CFBIQZQTWFHAJS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|