C9H10N3O5- — CID 7369996
4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate (PubChem CID 7369996) has the molecular formula C9H10N3O5- and a molecular weight of 240.19 g/mol. Its IUPAC name is 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate.
| Compound Name | 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate |
|---|---|
| PubChem CID | 7369996 |
| Molecular Formula | C9H10N3O5- |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate |
| SMILES | O=C([O-])CCC/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C9H11N3O5/c13-6(14)2-1-3-10-4-5-7(15)11-9(17)12-8(5)16/h4-5H,1-3H2,(H,13,14)(H2,11,12,15,16,17)/p-1/b10-4+ |
| InChIKey | RFCWJAKGIPWOMT-ONNFQVAWSA-M |
| XLogP | -2.43 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|