C12H14O6-2 — CID 7370024
(2R)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butanedioate (PubChem CID 7370024) has the molecular formula C12H14O6-2 and a molecular weight of 254.24 g/mol. Its IUPAC name is (2R)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butanedioate.
| Compound Name | (2R)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butanedioate |
|---|---|
| PubChem CID | 7370024 |
| Molecular Formula | C12H14O6-2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2R)-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)butanedioate |
| SMILES | CC1(C)CC(=O)C([C@@H](CC(=O)[O-])C(=O)[O-])=C(O)C1 |
| InChI | InChI=1S/C12H16O6/c1-12(2)4-7(13)10(8(14)5-12)6(11(17)18)3-9(15)16/h6,13H,3-5H2,1-2H3,(H,15,16)(H,17,18)/p-2/t6-/m1/s1 |
| InChIKey | AYLCMDOUMNVYJS-ZCFIWIBFSA-L |
| XLogP | -1.31 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |