C13H19N3O5 — CID 7370043
6-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]hexanoic acid (PubChem CID 7370043) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]hexanoic acid.
| Compound Name | 6-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]hexanoic acid |
|---|---|
| PubChem CID | 7370043 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]hexanoic acid |
| SMILES | CN1C(=O)C(/C=N/CCCCCC(=O)O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H19N3O5/c1-15-11(19)9(12(20)16(2)13(15)21)8-14-7-5-3-4-6-10(17)18/h8-9H,3-7H2,1-2H3,(H,17,18)/b14-8+ |
| InChIKey | ZBWNROMKYMEIBK-RIYZIHGNSA-N |
| XLogP | 0.37 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|