C22H21ClN4O — CID 7370409
[(5R,7R)-7-(4-chlorophenyl)-5-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-cyclopropylmethanone (PubChem CID 7370409) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is [(5R,7R)-7-(4-chlorophenyl)-5-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-cyclopropylmethanone.
| Compound Name | [(5R,7R)-7-(4-chlorophenyl)-5-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 7370409 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(5R,7R)-7-(4-chlorophenyl)-5-(4-methylphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-4-yl]-cyclopropylmethanone |
| SMILES | Cc1ccc([C@H]2C[C@H](c3ccc(Cl)cc3)n3ncnc3N2C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H21ClN4O/c1-14-2-4-15(5-3-14)19-12-20(16-8-10-18(23)11-9-16)27-22(24-13-25-27)26(19)21(28)17-6-7-17/h2-5,8-11,13,17,19-20H,6-7,12H2,1H3/t19-,20-/m1/s1 |
| InChIKey | NZQBEVHEADFVJJ-WOJBJXKFSA-N |
| XLogP | 4.72 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |