C12H10FN3OS — CID 7370765
4-fluoro-N-(5-prop-2-enyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 7370765) has the molecular formula C12H10FN3OS and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-fluoro-N-(5-prop-2-enyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-fluoro-N-(5-prop-2-enyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7370765 |
| Molecular Formula | C12H10FN3OS |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-fluoro-N-(5-prop-2-enyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCc1nnc(NC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C12H10FN3OS/c1-2-3-10-15-16-12(18-10)14-11(17)8-4-6-9(13)7-5-8/h2,4-7H,1,3H2,(H,14,16,17) |
| InChIKey | YUWQQZYPIPKIQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|