C21H20N3O4- — CID 7370896
1-[[4-(dimethylamino)phenyl]iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate (PubChem CID 7370896) has the molecular formula C21H20N3O4- and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate.
| Compound Name | 1-[[4-(dimethylamino)phenyl]iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate |
|---|---|
| PubChem CID | 7370896 |
| Molecular Formula | C21H20N3O4- |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]iminomethyl]-3-nitro-6,7,8,9-tetrahydrodibenzofuran-2-olate |
| SMILES | CN(C)c1ccc(/N=C/c2c([O-])c([N+](=O)[O-])cc3oc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-23(2)14-9-7-13(8-10-14)22-12-16-20-15-5-3-4-6-18(15)28-19(20)11-17(21(16)25)24(26)27/h7-12,25H,3-6H2,1-2H3/p-1/b22-12+ |
| InChIKey | MKGLOQXJFSBAEE-WSDLNYQXSA-M |
| XLogP | 4.11 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|