About 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 737179) has the molecular formula C11H9N3O3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 737179 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | NC(=O)Cc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C11H9N3O3S/c12-10(15)5-11-13-9(6-18-11)7-1-3-8(4-2-7)14(16)17/h1-4,6H,5H2,(H2,12,15) |
| InChIKey | DIRZWLIATNEVTJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide (CID 737179) is 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide is NC(=O)Cc1nc(-c2ccc([N+](=O)[O-])cc2)cs1.
What is the InChIKey of 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is DIRZWLIATNEVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3S/c12-10(15)5-11-13-9(6-18-11)7-1-3-8(4-2-7)14(16)17/h1-4,6H,5H2,(H2,12,15).
What are the key properties of 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide?
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 263.28 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 737179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).