About (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one
(4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one (PubChem CID 7371911) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one |
| PubChem CID | 7371911 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one |
| SMILES | C#CC[C@@H]1C(=O)N([C@@H]2CCOC(C)(C)C2)N=C1c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-4-8-16-17(14-9-6-5-7-10-14)20-21(18(16)22)15-11-12-23-19(2,3)13-15/h1,5-7,9-10,15-16H,8,11-13H2,2-3H3/t15-,16+/m1/s1 |
| InChIKey | GWJGDWLEGMQVMT-CVEARBPZSA-N |
| XLogP | 2.83 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one?
The IUPAC name of (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one (CID 7371911) is (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one.
What is the SMILES notation for (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one?
The canonical SMILES for (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one is C#CC[C@@H]1C(=O)N([C@@H]2CCOC(C)(C)C2)N=C1c1ccccc1.
What is the InChIKey of (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one?
The InChIKey is GWJGDWLEGMQVMT-CVEARBPZSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-4-8-16-17(14-9-6-5-7-10-14)20-21(18(16)22)15-11-12-23-19(2,3)13-15/h1,5-7,9-10,15-16H,8,11-13H2,2-3H3/t15-,16+/m1/s1.
What are the key properties of (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one?
(4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one has a molecular weight of 310.40 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-[(4R)-2,2-dimethyloxan-4-yl]-5-phenyl-4-prop-2-ynyl-4H-pyrazol-3-one is sourced from PubChem (CID 7371911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).