C17H16Cl2FNO2 — CID 7372385
(2S)-2-(2,3-dichlorophenoxy)-N-[(1S)-1-(4-fluorophenyl)ethyl]propanamide (PubChem CID 7372385) has the molecular formula C17H16Cl2FNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is (2S)-2-(2,3-dichlorophenoxy)-N-[(1S)-1-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | (2S)-2-(2,3-dichlorophenoxy)-N-[(1S)-1-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 7372385 |
| Molecular Formula | C17H16Cl2FNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (2S)-2-(2,3-dichlorophenoxy)-N-[(1S)-1-(4-fluorophenyl)ethyl]propanamide |
| SMILES | C[C@H](Oc1cccc(Cl)c1Cl)C(=O)N[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16Cl2FNO2/c1-10(12-6-8-13(20)9-7-12)21-17(22)11(2)23-15-5-3-4-14(18)16(15)19/h3-11H,1-2H3,(H,21,22)/t10-,11-/m0/s1 |
| InChIKey | QHQMKTJOICWRAF-QWRGUYRKSA-N |
| XLogP | 4.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |