About 3,4-diaminobenzonitrile
3,4-diaminobenzonitrile (PubChem CID 737285) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 3,4-diaminobenzonitrile.
Molecular Properties
| Compound Name | 3,4-diaminobenzonitrile |
| PubChem CID | 737285 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 3,4-diaminobenzonitrile |
| SMILES | N#Cc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H7N3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,9-10H2 |
| InChIKey | VWLLPPSBBHDXHK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminobenzonitrile?
The IUPAC name of 3,4-diaminobenzonitrile (CID 737285) is 3,4-diaminobenzonitrile.
What is the SMILES notation for 3,4-diaminobenzonitrile?
The canonical SMILES for 3,4-diaminobenzonitrile is N#Cc1ccc(N)c(N)c1.
What is the InChIKey of 3,4-diaminobenzonitrile?
The InChIKey is VWLLPPSBBHDXHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,9-10H2.
What are the key properties of 3,4-diaminobenzonitrile?
3,4-diaminobenzonitrile has a molecular weight of 133.15 g/mol, XLogP of 0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminobenzonitrile is sourced from PubChem (CID 737285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).