C17H16N2O5 — CID 7373054
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 7373054) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7373054 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O5/c1-18-13-5-3-2-4-12(13)17(21)22-9-16(20)19-11-6-7-14-15(8-11)24-10-23-14/h2-8,18H,9-10H2,1H3,(H,19,20) |
| InChIKey | UZYUMZUDTKVSQA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |