About 2H-imidazo[1,5-a]pyridine-3-thione
2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 737312) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 2H-imidazo[1,5-a]pyridine-3-thione.
Molecular Properties
| Compound Name | 2H-imidazo[1,5-a]pyridine-3-thione |
| PubChem CID | 737312 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | S=c1[nH]cc2ccccn12 |
| InChI | InChI=1S/C7H6N2S/c10-7-8-5-6-3-1-2-4-9(6)7/h1-5H,(H,8,10) |
| InChIKey | IPOYUTJDAMAUNH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2H-imidazo[1,5-a]pyridine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-imidazo[1,5-a]pyridine-3-thione?
The IUPAC name of 2H-imidazo[1,5-a]pyridine-3-thione (CID 737312) is 2H-imidazo[1,5-a]pyridine-3-thione.
What is the SMILES notation for 2H-imidazo[1,5-a]pyridine-3-thione?
The canonical SMILES for 2H-imidazo[1,5-a]pyridine-3-thione is S=c1[nH]cc2ccccn12.
What is the InChIKey of 2H-imidazo[1,5-a]pyridine-3-thione?
The InChIKey is IPOYUTJDAMAUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c10-7-8-5-6-3-1-2-4-9(6)7/h1-5H,(H,8,10).
What are the key properties of 2H-imidazo[1,5-a]pyridine-3-thione?
2H-imidazo[1,5-a]pyridine-3-thione has a molecular weight of 150.21 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-imidazo[1,5-a]pyridine-3-thione is sourced from PubChem (CID 737312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).