About [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate (PubChem CID 7373350) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate |
| PubChem CID | 7373350 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)c(C)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-14-8-9-17(15(2)12-14)20(24)25-13-19(23)22-11-10-18(21-22)16-6-4-3-5-7-16/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | SHZLMGBEWSKLHY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate?
The IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate (CID 7373350) is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate.
What is the SMILES notation for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate?
The canonical SMILES for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate is Cc1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)c(C)c1.
What is the InChIKey of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate?
The InChIKey is SHZLMGBEWSKLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-14-8-9-17(15(2)12-14)20(24)25-13-19(23)22-11-10-18(21-22)16-6-4-3-5-7-16/h3-9,12H,10-11,13H2,1-2H3.
What are the key properties of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate?
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate has a molecular weight of 336.39 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 2,4-dimethylbenzoate is sourced from PubChem (CID 7373350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).