C21H20F2N3S+ — CID 7373434
(4S,8E)-4-(4-fluorophenyl)-8-[(4-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydropyrido[4,3-d]pyrimidin-6-ium-2-thione (PubChem CID 7373434) has the molecular formula C21H20F2N3S+ and a molecular weight of 384.48 g/mol. Its IUPAC name is (4S,8E)-4-(4-fluorophenyl)-8-[(4-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydropyrido[4,3-d]pyrimidin-6-ium-2-thione.
| Compound Name | (4S,8E)-4-(4-fluorophenyl)-8-[(4-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydropyrido[4,3-d]pyrimidin-6-ium-2-thione |
|---|---|
| PubChem CID | 7373434 |
| Molecular Formula | C21H20F2N3S+ |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4S,8E)-4-(4-fluorophenyl)-8-[(4-fluorophenyl)methylidene]-6-methyl-1,3,4,5,6,7-hexahydropyrido[4,3-d]pyrimidin-6-ium-2-thione |
| SMILES | C[NH+]1CC2=C(NC(=S)N[C@H]2c2ccc(F)cc2)/C(=C/c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H19F2N3S/c1-26-11-15(10-13-2-6-16(22)7-3-13)20-18(12-26)19(24-21(27)25-20)14-4-8-17(23)9-5-14/h2-10,19H,11-12H2,1H3,(H2,24,25,27)/p+1/b15-10+/t19-/m0/s1 |
| InChIKey | RSSCIJGJORVHLT-XATQLNLPSA-O |
| XLogP | 2.35 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|