C19H27ClN3O5+ — CID 7373745
(5S)-3-(5-chloro-2,4-dimethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 7373745) has the molecular formula C19H27ClN3O5+ and a molecular weight of 412.89 g/mol. Its IUPAC name is (5S)-3-(5-chloro-2,4-dimethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5S)-3-(5-chloro-2,4-dimethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 7373745 |
| Molecular Formula | C19H27ClN3O5+ |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (5S)-3-(5-chloro-2,4-dimethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | COc1cc(OC)c(C2=NO[C@H](C(=O)NCCC[NH+]3CCOCC3)C2)cc1Cl |
| InChI | InChI=1S/C19H26ClN3O5/c1-25-16-12-17(26-2)14(20)10-13(16)15-11-18(28-22-15)19(24)21-4-3-5-23-6-8-27-9-7-23/h10,12,18H,3-9,11H2,1-2H3,(H,21,24)/p+1/t18-/m0/s1 |
| InChIKey | DNOXWAALFOAYOW-SFHVURJKSA-O |
| XLogP | 0.27 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|