About (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole
(5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole (PubChem CID 7374228) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole.
Molecular Properties
| Compound Name | (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole |
| PubChem CID | 7374228 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole |
| SMILES | C[C@@]1(c2ccccc2)CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C22H20N2/c1-22(19-13-7-3-8-14-19)17-21(18-11-5-2-6-12-18)23-24(22)20-15-9-4-10-16-20/h2-16H,17H2,1H3/t22-/m0/s1 |
| InChIKey | XCIHOQHTGRLYFF-QFIPXVFZSA-N |
| XLogP | 5.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole?
The IUPAC name of (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole (CID 7374228) is (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole.
What is the SMILES notation for (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole?
The canonical SMILES for (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole is C[C@@]1(c2ccccc2)CC(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole?
The InChIKey is XCIHOQHTGRLYFF-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H20N2/c1-22(19-13-7-3-8-14-19)17-21(18-11-5-2-6-12-18)23-24(22)20-15-9-4-10-16-20/h2-16H,17H2,1H3/t22-/m0/s1.
What are the key properties of (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole?
(5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole has a molecular weight of 312.42 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-1,3,5-triphenyl-4H-pyrazole is sourced from PubChem (CID 7374228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).