About 3-phenyl-1,2-oxazole-5-carboxylic acid
3-phenyl-1,2-oxazole-5-carboxylic acid (PubChem CID 737474) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-phenyl-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-phenyl-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 737474 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3-phenyl-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C10H7NO3/c12-10(13)9-6-8(11-14-9)7-4-2-1-3-5-7/h1-6H,(H,12,13) |
| InChIKey | YGTFDJRCCBKLDM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-phenyl-1,2-oxazole-5-carboxylic acid (CID 737474) is 3-phenyl-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-phenyl-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-phenyl-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(-c2ccccc2)no1.
What is the InChIKey of 3-phenyl-1,2-oxazole-5-carboxylic acid?
The InChIKey is YGTFDJRCCBKLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c12-10(13)9-6-8(11-14-9)7-4-2-1-3-5-7/h1-6H,(H,12,13).
What are the key properties of 3-phenyl-1,2-oxazole-5-carboxylic acid?
3-phenyl-1,2-oxazole-5-carboxylic acid has a molecular weight of 189.17 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 737474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).